3-Methyl-2-thiophenecarboxylic acid

Bulk supply high purity 3-Methyl-2-thiophenecarboxylic acid 23806-24-8, Paid sample available We provide high quality 3-Methyl-2-thiophenecarboxylic acid (CAS 23806-24-8), at a very affordable prices to our customers.

1.What is the 3-Methyl-2-thiophenecarboxylic acid ?

3-Methyl-2-thiophenecarboxylic acid is an organic compound that is characterized by its white to light yellow crystal powder appearance. It has been utilized in the synthesis of various metal carboxylate complexes, such as those involving zinc and cadmium. 3-Methyl-2-thiophenecarboxylic acid plays a significant role in the field of coordination chemistry and material science due to its ability to form stable complexes with metal ions.

Used in Coordination Chemistry:
3-Methyl-2-thiophenecarboxylic acid is used as a ligand in coordination chemistry for the formation of metal carboxylate complexes. Its application is based on its ability to chelate with metal ions, providing stability and unique properties to the resulting complexes.
Used in Material Science:
In the field of material science, 3-Methyl-2-thiophenecarboxylic acid is used as a building block for the synthesis of metal-organic frameworks (MOFs) and other coordination polymers. The application reason is its capacity to form extended structures with metal ions, which can exhibit interesting properties such as magnetism, conductivity, or gas adsorption.
Used in Pharmaceutical Industry:
3-Methyl-2-thiophenecarboxylic acid is used as an intermediate in the synthesis of various pharmaceutical compounds. Its application is due to its reactivity and the potential for functionalization, which allows for the development of new drugs with specific therapeutic properties.
Used in Chemical Synthesis:
3-Methyl-2-thiophenecarboxylic acid is used as a starting material or intermediate in the synthesis of a wide range of organic compounds, including dyes, pigments, and other specialty chemicals. The application reason is its versatile chemical reactivity, which allows for various functional group transformations and the creation of diverse molecular structures.

2.What is the CAS number for 3-Methyl-2-thiophenecarboxylic acid ?

The CAS number of 3-Methyl-2-thiophenecarboxylic acid is 23806-24-8.

More information of 3-Methyl-2-thiophenecarboxylic acid 23806-24-8 are:

3.What is the molecular formula of 3-Methyl-2-thiophenecarboxylic acid ?

The chemical formula of?3-Methyl-2-thiophenecarboxylic acid is C6H6O2S which containing 6 Carbon atoms,6 Hydrogen atoms,2 Oxygen atoms and 1 Sulfur atoms,and the molecular weight, and the molecular weight of 3-Methyl-2-thiophenecarboxylic acid is 142.178

4.What is 3-Methyl-2-thiophenecarboxylic acid(23806-24-8)used for?

3-Methyl-2-thiophenecarboxylic acid is an organic compound that is characterized by its white to light yellow crystal powder appearance. It has been utilized in the synthesis of various metal carboxylate complexes, such as those involving zinc and cadmium. 3-Methyl-2-thiophenecarboxylic acid plays a significant role in the field of coordination chemistry and material science due to its ability to form stable complexes with metal ions.

InChI:InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1

Relevant articles related to 3-Methyl-2-thiophenecarboxylic acid:

5.Bulk supply high purity 3-Methyl-2-thiophenecarboxylic acid 23806-24-8, Paid sample available

Suzhou Dabang Chemicals Co., ltd is a quality supplier of 3-Methyl-2-thiophenecarboxylic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 3-Methyl-2-thiophenecarboxylic acid 23806-24-8.