What is the 6-Methyl-1-octanol?

6-Methyl-1-octanol is , while it's Molecular Formula is C9H20O. Used in Perfumery Industry: 6-Methyl-1-octanol is used as a fragrance ingredient in perfumes for its ability to provide a pleasant and distinct scent. Its unique aroma profile contributes to the overall fragrance composition, enhancing the sensory experience of the end product. Used in Food Industry: In the food industry, 6-Methyl-1-octanol is used as a flavoring agent to impart specific tastes and aromas to various food products. Its use in food formulations helps create a more appealing and enjoyable flavor profile for consumers. Used in Paints and Coatings Industry: 6-Methyl-1-octanol is used as a solvent in the manufacturing of paints, coatings, and adhesives. Its solvent properties help in the proper dispersion of pigments and other components, ensuring a smooth application and optimal performance of the final product. Used in Plasticizers and Resins Production: In the production of plasticizers and resins, 6-Methyl-1-octanol plays a crucial role as a raw material. Its chemical properties contribute to the formation of high-quality plasticizers and resins, which are used in various applications, including the manufacturing of flexible plastics and coatings. Safety Considerations: It is important to handle 6-Methyl-1-octanol with care and follow safety guidelines due to its potential hazards, such as flammability and irritant properties. Proper storage, handling, and disposal practices should be implemented to minimize risks and ensure the safety of workers and the environment.

What is the CAS number for 6-Methyl-1-octanol?

The CAS number of 6-Methyl-1-octanol is 38514-05-5.

What is 6-Methyl-1-octanol (38514-05-5) used for?

6-Methyl-1-octanol, also known as 1-octanol-6-methyl, is a colorless liquid chemical compound with the molecular formula C9H20O. It has a slight odor and is insoluble in water. This versatile compound is widely used in various industries due to its unique properties.InChI:InChI=1/C9H20O/c1-3-9(2)7-5-4-6-8-10/h9-10H,3-8H2,1-2H3

What is the 6-Methyl-1-octanol?

6-Methyl-1-octanol is , while it's Molecular Formula is C9H20O. Used in Perfumery Industry: 6-Methyl-1-octanol is used as a fragrance ingredient in perfumes for its ability to provide a pleasant and distinct scent. Its unique aroma profile contributes to the overall fragrance composition, enhancing the sensory experience of the end product. Used in Food Industry: In the food industry, 6-Methyl-1-octanol is used as a flavoring agent to impart specific tastes and aromas to various food products. Its use in food formulations helps create a more appealing and enjoyable flavor profile for consumers. Used in Paints and Coatings Industry: 6-Methyl-1-octanol is used as a solvent in the manufacturing of paints, coatings, and adhesives. Its solvent properties help in the proper dispersion of pigments and other components, ensuring a smooth application and optimal performance of the final product. Used in Plasticizers and Resins Production: In the production of plasticizers and resins, 6-Methyl-1-octanol plays a crucial role as a raw material. Its chemical properties contribute to the formation of high-quality plasticizers and resins, which are used in various applications, including the manufacturing of flexible plastics and coatings. Safety Considerations: It is important to handle 6-Methyl-1-octanol with care and follow safety guidelines due to its potential hazards, such as flammability and irritant properties. Proper storage, handling, and disposal practices should be implemented to minimize risks and ensure the safety of workers and the environment.

What is the CAS number for 6-Methyl-1-octanol?

The CAS number of 6-Methyl-1-octanol is 38514-05-5.

What is 6-Methyl-1-octanol (38514-05-5) used for?

6-Methyl-1-octanol, also known as 1-octanol-6-methyl, is a colorless liquid chemical compound with the molecular formula C9H20O. It has a slight odor and is insoluble in water. This versatile compound is widely used in various industries due to its unique properties.InChI:InChI=1/C9H20O/c1-3-9(2)7-5-4-6-8-10/h9-10H,3-8H2,1-2H3

Your Location:Home > Others > 6-Methyl-1-octanol

Product classification

6-Methyl-1-octanol

Name: 6-Methyl-1-octanol
CAS: 38514-05-5
Purity: 99%

Inquiry

Details

Factory supply 6-Methyl-1-octanol 38514-05-5 with low price

Molecular Formula: C9H20O
Molecular Weight: 144.257
Vapor Pressure: 0.102mmHg at 25°C
Melting Point: 6.15°C (estimate)
Refractive Index: 1.43
Boiling Point: 196.6 °C at 760 mmHg
PKA: 15.20±0.10(Predicted)
Flash Point: 79.5 °C
PSA： 20.23000
Density: 0.824 g/cm³
LogP: 2.58520

6-Methyl-1-octanol(Cas 38514-05-5) Usage

General Description

6-Methyl-1-octanol, also known as 1-octanol-6-methyl, is a chemical compound with the molecular formula C9H20O. It is a colorless liquid with a slight odor and is insoluble in water. This chemical is commonly used as a fragrance ingredient in perfumes and as a flavoring agent in the food industry. It is also used as a solvent in various industries, including the manufacturing of paints, coatings, and adhesives. Additionally, 6-Methyl-1-octanol has applications in the production of plasticizers and resins. It is important to handle this chemical with care and follow safety guidelines due to its potential hazards, including flammability and irritant properties.

InChI:InChI=1/C9H20O/c1-3-9(2)7-5-4-6-8-10/h9-10H,3-8H2,1-2H3